C23H21FO5S2 — CID 135056193
(3R)-4,4-bis(benzenesulfonyl)-4-fluoro-3-methyl-1-phenylbutan-1-one (PubChem CID 135056193) has the molecular formula C23H21FO5S2 and a molecular weight of 460.55 g/mol. Its IUPAC name is (3R)-4,4-bis(benzenesulfonyl)-4-fluoro-3-methyl-1-phenylbutan-1-one.
| Compound Name | (3R)-4,4-bis(benzenesulfonyl)-4-fluoro-3-methyl-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 135056193 |
| Molecular Formula | C23H21FO5S2 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | (3R)-4,4-bis(benzenesulfonyl)-4-fluoro-3-methyl-1-phenylbutan-1-one |
| SMILES | C[C@H](CC(=O)c1ccccc1)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H21FO5S2/c1-18(17-22(25)19-11-5-2-6-12-19)23(24,30(26,27)20-13-7-3-8-14-20)31(28,29)21-15-9-4-10-16-21/h2-16,18H,17H2,1H3/t18-/m1/s1 |
| InChIKey | VWHURNYFJRODDB-GOSISDBHSA-N |
| XLogP | 4.47 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |