C27H34F3NO3 — CID 135056210
(1S)-1-(3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl)-2,2,2-trifluoro-1-(4-methoxyphenyl)ethanol (PubChem CID 135056210) has the molecular formula C27H34F3NO3 and a molecular weight of 477.57 g/mol. Its IUPAC name is (1S)-1-(3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl)-2,2,2-trifluoro-1-(4-methoxyphenyl)ethanol.
| Compound Name | (1S)-1-(3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl)-2,2,2-trifluoro-1-(4-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 135056210 |
| Molecular Formula | C27H34F3NO3 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | (1S)-1-(3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl)-2,2,2-trifluoro-1-(4-methoxyphenyl)ethanol |
| SMILES | COc1ccc([C@](O)(C2OC3CC(C)CCC3C(C)(C)N2Cc2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H34F3NO3/c1-18-10-15-22-23(16-18)34-24(31(25(22,2)3)17-19-8-6-5-7-9-19)26(32,27(28,29)30)20-11-13-21(33-4)14-12-20/h5-9,11-14,18,22-24,32H,10,15-17H2,1-4H3/t18?,22?,23?,24?,26-/m0/s1 |
| InChIKey | SSJXOLHEUBLVLH-AIMYMGESSA-N |
| XLogP | 5.89 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |