C25H40O5Si — CID 135056214
methyl (E,4R)-6-[(1S,5aS,9aS)-5a-[tert-butyl(dimethyl)silyl]oxy-9-oxo-2,2a,3,4,5,8-hexahydro-1H-cyclobuta[j]naphthalen-1-yl]-4-hydroxyhex-5-enoate (PubChem CID 135056214) has the molecular formula C25H40O5Si and a molecular weight of 448.68 g/mol. Its IUPAC name is methyl (E,4R)-6-[(1S,5aS,9aS)-5a-[tert-butyl(dimethyl)silyl]oxy-9-oxo-2,2a,3,4,5,8-hexahydro-1H-cyclobuta[j]naphthalen-1-yl]-4-hydroxyhex-5-enoate.
| Compound Name | methyl (E,4R)-6-[(1S,5aS,9aS)-5a-[tert-butyl(dimethyl)silyl]oxy-9-oxo-2,2a,3,4,5,8-hexahydro-1H-cyclobuta[j]naphthalen-1-yl]-4-hydroxyhex-5-enoate |
|---|---|
| PubChem CID | 135056214 |
| Molecular Formula | C25H40O5Si |
| Molecular Weight | 448.68 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | methyl (E,4R)-6-[(1S,5aS,9aS)-5a-[tert-butyl(dimethyl)silyl]oxy-9-oxo-2,2a,3,4,5,8-hexahydro-1H-cyclobuta[j]naphthalen-1-yl]-4-hydroxyhex-5-enoate |
| SMILES | COC(=O)CC[C@@H](O)/C=C/[C@@H]1CC2CCC[C@]3(O[Si](C)(C)C(C)(C)C)C=CCC(=O)[C@@]213 |
| InChI | InChI=1S/C25H40O5Si/c1-23(2,3)31(5,6)30-24-15-7-9-18-17-19(25(18,24)21(27)10-8-16-24)11-12-20(26)13-14-22(28)29-4/h8,11-12,16,18-20,26H,7,9-10,13-15,17H2,1-6H3/b12-11+/t18?,19-,20+,24+,25-/m1/s1 |
| InChIKey | PQGZPYGSIGADJH-NGORRKOASA-N |
| XLogP | 4.95 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.68 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|