C24H27NO8 — CID 135056226
(2R)-2-[(7-acetamido-6-phenoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl)oxy]propanoic acid (PubChem CID 135056226) has the molecular formula C24H27NO8 and a molecular weight of 457.48 g/mol. Its IUPAC name is (2R)-2-[(7-acetamido-6-phenoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl)oxy]propanoic acid.
| Compound Name | (2R)-2-[(7-acetamido-6-phenoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl)oxy]propanoic acid |
|---|---|
| PubChem CID | 135056226 |
| Molecular Formula | C24H27NO8 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | (2R)-2-[(7-acetamido-6-phenoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl)oxy]propanoic acid |
| SMILES | CC(=O)NC1C(Oc2ccccc2)OC2COC(c3ccccc3)OC2C1O[C@H](C)C(=O)O |
| InChI | InChI=1S/C24H27NO8/c1-14(22(27)28)30-21-19(25-15(2)26)24(31-17-11-7-4-8-12-17)32-18-13-29-23(33-20(18)21)16-9-5-3-6-10-16/h3-12,14,18-21,23-24H,13H2,1-2H3,(H,25,26)(H,27,28)/t14-,18?,19?,20?,21?,23?,24?/m1/s1 |
| InChIKey | WUKHPPMEFIBPBN-NYQYXDTHSA-N |
| XLogP | 2.27 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |