About [(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]azanium chloride
[(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]azanium chloride (PubChem CID 135056688) has the molecular formula C8H8BrClF3N
and a molecular weight of 290.51 g/mol. Its IUPAC name is [(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]azanium chloride.
Molecular Properties
| Compound Name | [(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]azanium chloride |
| PubChem CID | 135056688 |
| Molecular Formula | C8H8BrClF3N |
| Molecular Weight | 290.51 g/mol |
| Exact Mass | 288.95 |
| IUPAC Name | [(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]azanium chloride |
| SMILES | [Cl-].[NH3+][C@@H](c1ccc(Br)cc1)C(F)(F)F |
| InChI | InChI=1S/C8H7BrF3N.ClH/c9-6-3-1-5(2-4-6)7(13)8(10,11)12;/h1-4,7H,13H2;1H/t7-;/m0./s1 |
| InChIKey | XESDERGPILUSRV-FJXQXJEOSA-N |
| XLogP | -0.70 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.51 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze [(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]azanium chloride?
The IUPAC name of [(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]azanium chloride (CID 135056688) is [(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]azanium chloride.
What is the SMILES notation for [(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]azanium chloride?
The canonical SMILES for [(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]azanium chloride is [Cl-].[NH3+][C@@H](c1ccc(Br)cc1)C(F)(F)F.
What is the InChIKey of [(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]azanium chloride?
The InChIKey is XESDERGPILUSRV-FJXQXJEOSA-N. The full InChI is InChI=1S/C8H7BrF3N.ClH/c9-6-3-1-5(2-4-6)7(13)8(10,11)12;/h1-4,7H,13H2;1H/t7-;/m0./s1.
What are the key properties of [(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]azanium chloride?
[(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]azanium chloride has a molecular weight of 290.51 g/mol, XLogP of -0.70, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]azanium chloride is sourced from PubChem (CID 135056688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).