C12H18O2S — CID 135056692
(3R,4R)-1-phenylsulfanylhexane-3,4-diol (PubChem CID 135056692) has the molecular formula C12H18O2S and a molecular weight of 226.34 g/mol. Its IUPAC name is (3R,4R)-1-phenylsulfanylhexane-3,4-diol.
| Compound Name | (3R,4R)-1-phenylsulfanylhexane-3,4-diol |
|---|---|
| PubChem CID | 135056692 |
| Molecular Formula | C12H18O2S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | (3R,4R)-1-phenylsulfanylhexane-3,4-diol |
| SMILES | CC[C@@H](O)[C@H](O)CCSc1ccccc1 |
| InChI | InChI=1S/C12H18O2S/c1-2-11(13)12(14)8-9-15-10-6-4-3-5-7-10/h3-7,11-14H,2,8-9H2,1H3/t11-,12-/m1/s1 |
| InChIKey | JJVBGZFGMXDTTJ-VXGBXAGGSA-N |
| XLogP | 2.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |