About (3-bromo-1,2-oxazol-5-yl)methylazanium chloride
(3-bromo-1,2-oxazol-5-yl)methylazanium chloride (PubChem CID 135056927) has the molecular formula C4H6BrClN2O
and a molecular weight of 213.46 g/mol. Its IUPAC name is (3-bromo-1,2-oxazol-5-yl)methylazanium chloride.
Molecular Properties
| Compound Name | (3-bromo-1,2-oxazol-5-yl)methylazanium chloride |
| PubChem CID | 135056927 |
| Molecular Formula | C4H6BrClN2O |
| Molecular Weight | 213.46 g/mol |
| Exact Mass | 211.94 |
| IUPAC Name | (3-bromo-1,2-oxazol-5-yl)methylazanium chloride |
| SMILES | [Cl-].[NH3+]Cc1cc(Br)no1 |
| InChI | InChI=1S/C4H5BrN2O.ClH/c5-4-1-3(2-6)8-7-4;/h1H,2,6H2;1H |
| InChIKey | DLEMWTVPLLIRRI-UHFFFAOYSA-N |
| XLogP | -2.82 |
| TPSA | 53.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.46 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-bromo-1,2-oxazol-5-yl)methylazanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromo-1,2-oxazol-5-yl)methylazanium chloride?
The IUPAC name of (3-bromo-1,2-oxazol-5-yl)methylazanium chloride (CID 135056927) is (3-bromo-1,2-oxazol-5-yl)methylazanium chloride.
What is the SMILES notation for (3-bromo-1,2-oxazol-5-yl)methylazanium chloride?
The canonical SMILES for (3-bromo-1,2-oxazol-5-yl)methylazanium chloride is [Cl-].[NH3+]Cc1cc(Br)no1.
What is the InChIKey of (3-bromo-1,2-oxazol-5-yl)methylazanium chloride?
The InChIKey is DLEMWTVPLLIRRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5BrN2O.ClH/c5-4-1-3(2-6)8-7-4;/h1H,2,6H2;1H.
What are the key properties of (3-bromo-1,2-oxazol-5-yl)methylazanium chloride?
(3-bromo-1,2-oxazol-5-yl)methylazanium chloride has a molecular weight of 213.46 g/mol, XLogP of -2.82, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromo-1,2-oxazol-5-yl)methylazanium chloride is sourced from PubChem (CID 135056927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).