About (2R,3S)-1,1-dichloro-3-methylpent-4-en-2-ol
(2R,3S)-1,1-dichloro-3-methylpent-4-en-2-ol (PubChem CID 135057099) has the molecular formula C6H10Cl2O
and a molecular weight of 169.05 g/mol. Its IUPAC name is (2R,3S)-1,1-dichloro-3-methylpent-4-en-2-ol.
Molecular Properties
| Compound Name | (2R,3S)-1,1-dichloro-3-methylpent-4-en-2-ol |
| PubChem CID | 135057099 |
| Molecular Formula | C6H10Cl2O |
| Molecular Weight | 169.05 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | (2R,3S)-1,1-dichloro-3-methylpent-4-en-2-ol |
| SMILES | C=C[C@H](C)[C@@H](O)C(Cl)Cl |
| InChI | InChI=1S/C6H10Cl2O/c1-3-4(2)5(9)6(7)8/h3-6,9H,1H2,2H3/t4-,5+/m0/s1 |
| InChIKey | RMLXRBFVJXPAQM-CRCLSJGQSA-N |
| XLogP | 1.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.05 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R,3S)-1,1-dichloro-3-methylpent-4-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-1,1-dichloro-3-methylpent-4-en-2-ol?
The IUPAC name of (2R,3S)-1,1-dichloro-3-methylpent-4-en-2-ol (CID 135057099) is (2R,3S)-1,1-dichloro-3-methylpent-4-en-2-ol.
What is the SMILES notation for (2R,3S)-1,1-dichloro-3-methylpent-4-en-2-ol?
The canonical SMILES for (2R,3S)-1,1-dichloro-3-methylpent-4-en-2-ol is C=C[C@H](C)[C@@H](O)C(Cl)Cl.
What is the InChIKey of (2R,3S)-1,1-dichloro-3-methylpent-4-en-2-ol?
The InChIKey is RMLXRBFVJXPAQM-CRCLSJGQSA-N. The full InChI is InChI=1S/C6H10Cl2O/c1-3-4(2)5(9)6(7)8/h3-6,9H,1H2,2H3/t4-,5+/m0/s1.
What are the key properties of (2R,3S)-1,1-dichloro-3-methylpent-4-en-2-ol?
(2R,3S)-1,1-dichloro-3-methylpent-4-en-2-ol has a molecular weight of 169.05 g/mol, XLogP of 1.97, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-1,1-dichloro-3-methylpent-4-en-2-ol is sourced from PubChem (CID 135057099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).