About 1-(4-bromophenyl)-2,2-difluoroethanamine;hydrochloride
1-(4-bromophenyl)-2,2-difluoroethanamine;hydrochloride (PubChem CID 135057267) has the molecular formula C8H9BrClF2N
and a molecular weight of 272.52 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2,2-difluoroethanamine;hydrochloride.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)-2,2-difluoroethanamine;hydrochloride |
| PubChem CID | 135057267 |
| Molecular Formula | C8H9BrClF2N |
| Molecular Weight | 272.52 g/mol |
| Exact Mass | 270.96 |
| IUPAC Name | 1-(4-bromophenyl)-2,2-difluoroethanamine;hydrochloride |
| SMILES | Cl.NC(c1ccc(Br)cc1)C(F)F |
| InChI | InChI=1S/C8H8BrF2N.ClH/c9-6-3-1-5(2-4-6)7(12)8(10)11;/h1-4,7-8H,12H2;1H |
| InChIKey | ACHCXLPCNPXNTF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4-bromophenyl)-2,2-difluoroethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)-2,2-difluoroethanamine;hydrochloride?
The IUPAC name of 1-(4-bromophenyl)-2,2-difluoroethanamine;hydrochloride (CID 135057267) is 1-(4-bromophenyl)-2,2-difluoroethanamine;hydrochloride.
What is the SMILES notation for 1-(4-bromophenyl)-2,2-difluoroethanamine;hydrochloride?
The canonical SMILES for 1-(4-bromophenyl)-2,2-difluoroethanamine;hydrochloride is Cl.NC(c1ccc(Br)cc1)C(F)F.
What is the InChIKey of 1-(4-bromophenyl)-2,2-difluoroethanamine;hydrochloride?
The InChIKey is ACHCXLPCNPXNTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrF2N.ClH/c9-6-3-1-5(2-4-6)7(12)8(10)11;/h1-4,7-8H,12H2;1H.
What are the key properties of 1-(4-bromophenyl)-2,2-difluoroethanamine;hydrochloride?
1-(4-bromophenyl)-2,2-difluoroethanamine;hydrochloride has a molecular weight of 272.52 g/mol, XLogP of 3.14, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)-2,2-difluoroethanamine;hydrochloride is sourced from PubChem (CID 135057267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).