About ethyl (4R,6R)-6-ethyl-2,4-dihydroxy-3-methylidenecyclohexene-1-carboxylate
ethyl (4R,6R)-6-ethyl-2,4-dihydroxy-3-methylidenecyclohexene-1-carboxylate (PubChem CID 135057279) has the molecular formula C12H18O4
and a molecular weight of 226.27 g/mol. Its IUPAC name is ethyl (4R,6R)-6-ethyl-2,4-dihydroxy-3-methylidenecyclohexene-1-carboxylate.
Molecular Properties
| Compound Name | ethyl (4R,6R)-6-ethyl-2,4-dihydroxy-3-methylidenecyclohexene-1-carboxylate |
| PubChem CID | 135057279 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | ethyl (4R,6R)-6-ethyl-2,4-dihydroxy-3-methylidenecyclohexene-1-carboxylate |
| SMILES | C=C1C(O)=C(C(=O)OCC)[C@H](CC)C[C@H]1O |
| InChI | InChI=1S/C12H18O4/c1-4-8-6-9(13)7(3)11(14)10(8)12(15)16-5-2/h8-9,13-14H,3-6H2,1-2H3/t8-,9-/m1/s1 |
| InChIKey | JVTJBWHAGASAJK-RKDXNWHRSA-N |
| XLogP | 1.71 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (4R,6R)-6-ethyl-2,4-dihydroxy-3-methylidenecyclohexene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (4R,6R)-6-ethyl-2,4-dihydroxy-3-methylidenecyclohexene-1-carboxylate?
The IUPAC name of ethyl (4R,6R)-6-ethyl-2,4-dihydroxy-3-methylidenecyclohexene-1-carboxylate (CID 135057279) is ethyl (4R,6R)-6-ethyl-2,4-dihydroxy-3-methylidenecyclohexene-1-carboxylate.
What is the SMILES notation for ethyl (4R,6R)-6-ethyl-2,4-dihydroxy-3-methylidenecyclohexene-1-carboxylate?
The canonical SMILES for ethyl (4R,6R)-6-ethyl-2,4-dihydroxy-3-methylidenecyclohexene-1-carboxylate is C=C1C(O)=C(C(=O)OCC)[C@H](CC)C[C@H]1O.
What is the InChIKey of ethyl (4R,6R)-6-ethyl-2,4-dihydroxy-3-methylidenecyclohexene-1-carboxylate?
The InChIKey is JVTJBWHAGASAJK-RKDXNWHRSA-N. The full InChI is InChI=1S/C12H18O4/c1-4-8-6-9(13)7(3)11(14)10(8)12(15)16-5-2/h8-9,13-14H,3-6H2,1-2H3/t8-,9-/m1/s1.
What are the key properties of ethyl (4R,6R)-6-ethyl-2,4-dihydroxy-3-methylidenecyclohexene-1-carboxylate?
ethyl (4R,6R)-6-ethyl-2,4-dihydroxy-3-methylidenecyclohexene-1-carboxylate has a molecular weight of 226.27 g/mol, XLogP of 1.71, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (4R,6R)-6-ethyl-2,4-dihydroxy-3-methylidenecyclohexene-1-carboxylate is sourced from PubChem (CID 135057279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).