C11H16O3 — CID 135057289
(6E)-9-acetyl-2,3,4,5,8,9-hexahydrooxecin-10-one (PubChem CID 135057289) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (6E)-9-acetyl-2,3,4,5,8,9-hexahydrooxecin-10-one.
| Compound Name | (6E)-9-acetyl-2,3,4,5,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 135057289 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (6E)-9-acetyl-2,3,4,5,8,9-hexahydrooxecin-10-one |
| SMILES | CC(=O)C1C/C=C/CCCCOC1=O |
| InChI | InChI=1S/C11H16O3/c1-9(12)10-7-5-3-2-4-6-8-14-11(10)13/h3,5,10H,2,4,6-8H2,1H3/b5-3+ |
| InChIKey | ICNGUQLZGBQSHR-HWKANZROSA-N |
| XLogP | 1.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|