About [2-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)-5-phenylphenyl] acetate
[2-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)-5-phenylphenyl] acetate (PubChem CID 135057485) has the molecular formula C23H19NO3
and a molecular weight of 357.41 g/mol. Its IUPAC name is [2-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)-5-phenylphenyl] acetate.
Molecular Properties
| Compound Name | [2-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)-5-phenylphenyl] acetate |
| PubChem CID | 135057485 |
| Molecular Formula | C23H19NO3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | [2-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)-5-phenylphenyl] acetate |
| SMILES | CC(=O)Oc1cc(-c2ccccc2)ccc1-c1ccc2c(n1)CCCC2=O |
| InChI | InChI=1S/C23H19NO3/c1-15(25)27-23-14-17(16-6-3-2-4-7-16)10-11-19(23)21-13-12-18-20(24-21)8-5-9-22(18)26/h2-4,6-7,10-14H,5,8-9H2,1H3 |
| InChIKey | XZQCTUQLCAFMSN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)-5-phenylphenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)-5-phenylphenyl] acetate?
The IUPAC name of [2-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)-5-phenylphenyl] acetate (CID 135057485) is [2-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)-5-phenylphenyl] acetate.
What is the SMILES notation for [2-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)-5-phenylphenyl] acetate?
The canonical SMILES for [2-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)-5-phenylphenyl] acetate is CC(=O)Oc1cc(-c2ccccc2)ccc1-c1ccc2c(n1)CCCC2=O.
What is the InChIKey of [2-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)-5-phenylphenyl] acetate?
The InChIKey is XZQCTUQLCAFMSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19NO3/c1-15(25)27-23-14-17(16-6-3-2-4-7-16)10-11-19(23)21-13-12-18-20(24-21)8-5-9-22(18)26/h2-4,6-7,10-14H,5,8-9H2,1H3.
What are the key properties of [2-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)-5-phenylphenyl] acetate?
[2-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)-5-phenylphenyl] acetate has a molecular weight of 357.41 g/mol, XLogP of 4.86, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(5-oxo-7,8-dihydro-6H-quinolin-2-yl)-5-phenylphenyl] acetate is sourced from PubChem (CID 135057485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).