C14H29IOSi2 — CID 135057522
(4Z,7E)-8-iodo-5,8-bis(trimethylsilyl)octa-4,7-dien-1-ol (PubChem CID 135057522) has the molecular formula C14H29IOSi2 and a molecular weight of 396.46 g/mol. Its IUPAC name is (4Z,7E)-8-iodo-5,8-bis(trimethylsilyl)octa-4,7-dien-1-ol.
| Compound Name | (4Z,7E)-8-iodo-5,8-bis(trimethylsilyl)octa-4,7-dien-1-ol |
|---|---|
| PubChem CID | 135057522 |
| Molecular Formula | C14H29IOSi2 |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | (4Z,7E)-8-iodo-5,8-bis(trimethylsilyl)octa-4,7-dien-1-ol |
| SMILES | C[Si](C)(C)/C(=C\CCCO)C/C=C(/I)[Si](C)(C)C |
| InChI | InChI=1S/C14H29IOSi2/c1-17(2,3)13(9-7-8-12-16)10-11-14(15)18(4,5)6/h9,11,16H,7-8,10,12H2,1-6H3/b13-9-,14-11- |
| InChIKey | BCSGZVLHUBBMGT-GUMNZBQSSA-N |
| XLogP | 5.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|