C19H15F7N2O3 — CID 135057736
5-methoxy-2-morpholin-4-yl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]benzamide (PubChem CID 135057736) has the molecular formula C19H15F7N2O3 and a molecular weight of 452.33 g/mol. Its IUPAC name is 5-methoxy-2-morpholin-4-yl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 5-methoxy-2-morpholin-4-yl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 135057736 |
| Molecular Formula | C19H15F7N2O3 |
| Molecular Weight | 452.33 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 5-methoxy-2-morpholin-4-yl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]benzamide |
| SMILES | COc1ccc(N2CCOCC2)c(C(=O)Nc2c(F)c(F)c(C(F)(F)F)c(F)c2F)c1 |
| InChI | InChI=1S/C19H15F7N2O3/c1-30-9-2-3-11(28-4-6-31-7-5-28)10(8-9)18(29)27-17-15(22)13(20)12(19(24,25)26)14(21)16(17)23/h2-3,8H,4-7H2,1H3,(H,27,29) |
| InChIKey | ONDMMMUHAJEACJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.33 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|