C13H6F7NO — CID 135057869
1-methyl-5-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pyridin-2-one (PubChem CID 135057869) has the molecular formula C13H6F7NO and a molecular weight of 325.18 g/mol. Its IUPAC name is 1-methyl-5-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pyridin-2-one.
| Compound Name | 1-methyl-5-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pyridin-2-one |
|---|---|
| PubChem CID | 135057869 |
| Molecular Formula | C13H6F7NO |
| Molecular Weight | 325.18 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 1-methyl-5-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pyridin-2-one |
| SMILES | Cn1cc(-c2c(F)c(F)c(C(F)(F)F)c(F)c2F)ccc1=O |
| InChI | InChI=1S/C13H6F7NO/c1-21-4-5(2-3-6(21)22)7-9(14)11(16)8(13(18,19)20)12(17)10(7)15/h2-4H,1H3 |
| InChIKey | IYFAVVDCJDUYDP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.18 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|