C21H21BClNO2 — CID 135058202
3-chloro-2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]pyridine (PubChem CID 135058202) has the molecular formula C21H21BClNO2 and a molecular weight of 365.67 g/mol. Its IUPAC name is 3-chloro-2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]pyridine.
| Compound Name | 3-chloro-2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]pyridine |
|---|---|
| PubChem CID | 135058202 |
| Molecular Formula | C21H21BClNO2 |
| Molecular Weight | 365.67 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 3-chloro-2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]pyridine |
| SMILES | CC1(C)OB(c2ccc3ccccc3c2-c2ncccc2Cl)OC1(C)C |
| InChI | InChI=1S/C21H21BClNO2/c1-20(2)21(3,4)26-22(25-20)16-12-11-14-8-5-6-9-15(14)18(16)19-17(23)10-7-13-24-19/h5-13H,1-4H3 |
| InChIKey | QNEGBYAWHKXMOF-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.67 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|