About [(1Z)-4,8-dimethylnona-1,7-dienyl]-trimethylsilane
[(1Z)-4,8-dimethylnona-1,7-dienyl]-trimethylsilane (PubChem CID 135058376) has the molecular formula C14H28Si
and a molecular weight of 224.46 g/mol. Its IUPAC name is [(1Z)-4,8-dimethylnona-1,7-dienyl]-trimethylsilane.
Molecular Properties
| Compound Name | [(1Z)-4,8-dimethylnona-1,7-dienyl]-trimethylsilane |
|---|
| PubChem CID | 135058376 |
|---|
| Molecular Formula | C14H28Si |
|---|
| Molecular Weight | 224.46 g/mol |
|---|
| Exact Mass | 224.20 |
|---|
| IUPAC Name | [(1Z)-4,8-dimethylnona-1,7-dienyl]-trimethylsilane |
|---|
| SMILES | CC(C)=CCCC(C)C/C=C\[Si](C)(C)C |
|---|
| InChI | InChI=1S/C14H28Si/c1-13(2)9-7-10-14(3)11-8-12-15(4,5)6/h8-9,12,14H,7,10-11H2,1-6H3/b12-8- |
|---|
| InChIKey | VKZQQQVWQLYPBS-WQLSENKSSA-N |
|---|
| XLogP | 5.19 |
|---|
| TPSA | 0.00 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | |
|---|
| Rotatable Bonds | 6 |
|---|
| Heavy Atoms | 15 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
1 violation
| Rule | Value |
|---|
| MW ≤ 500 | 224.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1Z)-4,8-dimethylnona-1,7-dienyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1Z)-4,8-dimethylnona-1,7-dienyl]-trimethylsilane?
The IUPAC name of [(1Z)-4,8-dimethylnona-1,7-dienyl]-trimethylsilane (CID 135058376) is [(1Z)-4,8-dimethylnona-1,7-dienyl]-trimethylsilane.
What is the SMILES notation for [(1Z)-4,8-dimethylnona-1,7-dienyl]-trimethylsilane?
The canonical SMILES for [(1Z)-4,8-dimethylnona-1,7-dienyl]-trimethylsilane is CC(C)=CCCC(C)C/C=C\[Si](C)(C)C.
What is the InChIKey of [(1Z)-4,8-dimethylnona-1,7-dienyl]-trimethylsilane?
The InChIKey is VKZQQQVWQLYPBS-WQLSENKSSA-N. The full InChI is InChI=1S/C14H28Si/c1-13(2)9-7-10-14(3)11-8-12-15(4,5)6/h8-9,12,14H,7,10-11H2,1-6H3/b12-8-.
What are the key properties of [(1Z)-4,8-dimethylnona-1,7-dienyl]-trimethylsilane?
[(1Z)-4,8-dimethylnona-1,7-dienyl]-trimethylsilane has a molecular weight of 224.46 g/mol, XLogP of 5.19, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(1Z)-4,8-dimethylnona-1,7-dienyl]-trimethylsilane is sourced from PubChem (CID 135058376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).