C29H20O2S2 — CID 135058714
2,3,7,8-tetraphenyl-1,6-dioxa-4,9-dithiaspiro[4.4]nona-2,7-diene (PubChem CID 135058714) has the molecular formula C29H20O2S2 and a molecular weight of 464.61 g/mol. Its IUPAC name is 2,3,7,8-tetraphenyl-1,6-dioxa-4,9-dithiaspiro[4.4]nona-2,7-diene.
| Compound Name | 2,3,7,8-tetraphenyl-1,6-dioxa-4,9-dithiaspiro[4.4]nona-2,7-diene |
|---|---|
| PubChem CID | 135058714 |
| Molecular Formula | C29H20O2S2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | 2,3,7,8-tetraphenyl-1,6-dioxa-4,9-dithiaspiro[4.4]nona-2,7-diene |
| SMILES | c1ccc(C2=C(c3ccccc3)SC3(O2)OC(c2ccccc2)=C(c2ccccc2)S3)cc1 |
| InChI | InChI=1S/C29H20O2S2/c1-5-13-21(14-6-1)25-27(23-17-9-3-10-18-23)32-29(30-25)31-26(22-15-7-2-8-16-22)28(33-29)24-19-11-4-12-20-24/h1-20H |
| InChIKey | UGXDKLWJLDWQPU-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|