C17H14ClNO3 — CID 135058824
4-(4-chlorophenyl)-1,6-dimethoxyquinolin-2-one (PubChem CID 135058824) has the molecular formula C17H14ClNO3 and a molecular weight of 315.76 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1,6-dimethoxyquinolin-2-one.
| Compound Name | 4-(4-chlorophenyl)-1,6-dimethoxyquinolin-2-one |
|---|---|
| PubChem CID | 135058824 |
| Molecular Formula | C17H14ClNO3 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 4-(4-chlorophenyl)-1,6-dimethoxyquinolin-2-one |
| SMILES | COc1ccc2c(c1)c(-c1ccc(Cl)cc1)cc(=O)n2OC |
| InChI | InChI=1S/C17H14ClNO3/c1-21-13-7-8-16-15(9-13)14(10-17(20)19(16)22-2)11-3-5-12(18)6-4-11/h3-10H,1-2H3 |
| InChIKey | GAXNSZIGZXYKMK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |