C6H12O11P2-2 — CID 135058866
[[(3R)-4-carboxy-3-hydroxy-3-methylbutoxy]-oxidophosphoryl]oxy hydrogen phosphate (PubChem CID 135058866) has the molecular formula C6H12O11P2-2 and a molecular weight of 322.10 g/mol. Its IUPAC name is [[(3R)-4-carboxy-3-hydroxy-3-methylbutoxy]-oxidophosphoryl]oxy hydrogen phosphate.
| Compound Name | [[(3R)-4-carboxy-3-hydroxy-3-methylbutoxy]-oxidophosphoryl]oxy hydrogen phosphate |
|---|---|
| PubChem CID | 135058866 |
| Molecular Formula | C6H12O11P2-2 |
| Molecular Weight | 322.10 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | [[(3R)-4-carboxy-3-hydroxy-3-methylbutoxy]-oxidophosphoryl]oxy hydrogen phosphate |
| SMILES | C[C@@](O)(CCOP(=O)([O-])OOP(=O)([O-])O)CC(=O)O |
| InChI | InChI=1S/C6H14O11P2/c1-6(9,4-5(7)8)2-3-15-19(13,14)17-16-18(10,11)12/h9H,2-4H2,1H3,(H,7,8)(H,13,14)(H2,10,11,12)/p-2/t6-/m1/s1 |
| InChIKey | HNOXBDWDFNFCQC-ZCFIWIBFSA-L |
| XLogP | -1.50 |
| TPSA | 185.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.10 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|