C20H14Cl2N4O4S — CID 135058871
(11Z)-4-(2,6-dichlorophenyl)-11-[(4-nitrophenyl)methylidene]-2-oxa-12-thia-3,5,9-triazatricyclo[7.3.0.01,5]dodec-3-en-10-one (PubChem CID 135058871) has the molecular formula C20H14Cl2N4O4S and a molecular weight of 477.33 g/mol. Its IUPAC name is (11Z)-4-(2,6-dichlorophenyl)-11-[(4-nitrophenyl)methylidene]-2-oxa-12-thia-3,5,9-triazatricyclo[7.3.0.01,5]dodec-3-en-10-one.
| Compound Name | (11Z)-4-(2,6-dichlorophenyl)-11-[(4-nitrophenyl)methylidene]-2-oxa-12-thia-3,5,9-triazatricyclo[7.3.0.01,5]dodec-3-en-10-one |
|---|---|
| PubChem CID | 135058871 |
| Molecular Formula | C20H14Cl2N4O4S |
| Molecular Weight | 477.33 g/mol |
| Exact Mass | 476.01 |
| IUPAC Name | (11Z)-4-(2,6-dichlorophenyl)-11-[(4-nitrophenyl)methylidene]-2-oxa-12-thia-3,5,9-triazatricyclo[7.3.0.01,5]dodec-3-en-10-one |
| SMILES | O=C1/C(=C/c2ccc([N+](=O)[O-])cc2)SC23ON=C(c4c(Cl)cccc4Cl)N2CCCN13 |
| InChI | InChI=1S/C20H14Cl2N4O4S/c21-14-3-1-4-15(22)17(14)18-23-30-20-24(18)9-2-10-25(20)19(27)16(31-20)11-12-5-7-13(8-6-12)26(28)29/h1,3-8,11H,2,9-10H2/b16-11- |
| InChIKey | UUATUMNFBXKVFZ-WJDWOHSUSA-N |
| XLogP | 4.53 |
| TPSA | 88.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.33 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|