C17H23NO2 — CID 135058963
tert-butyl (4aS,9aS)-1,2,3,4,4a,9a-hexahydrocarbazole-9-carboxylate (PubChem CID 135058963) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is tert-butyl (4aS,9aS)-1,2,3,4,4a,9a-hexahydrocarbazole-9-carboxylate.
| Compound Name | tert-butyl (4aS,9aS)-1,2,3,4,4a,9a-hexahydrocarbazole-9-carboxylate |
|---|---|
| PubChem CID | 135058963 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | tert-butyl (4aS,9aS)-1,2,3,4,4a,9a-hexahydrocarbazole-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1c2ccccc2[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C17H23NO2/c1-17(2,3)20-16(19)18-14-10-6-4-8-12(14)13-9-5-7-11-15(13)18/h4,6,8,10,13,15H,5,7,9,11H2,1-3H3/t13-,15-/m0/s1 |
| InChIKey | GSWOQJZYPPYENG-ZFWWWQNUSA-N |
| XLogP | 4.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |