C17H17ClN2O — CID 135059748
9-butyl-4-chloro-2-methylpyrido[2,3-b]indole-3-carbaldehyde (PubChem CID 135059748) has the molecular formula C17H17ClN2O and a molecular weight of 300.79 g/mol. Its IUPAC name is 9-butyl-4-chloro-2-methylpyrido[2,3-b]indole-3-carbaldehyde.
| Compound Name | 9-butyl-4-chloro-2-methylpyrido[2,3-b]indole-3-carbaldehyde |
|---|---|
| PubChem CID | 135059748 |
| Molecular Formula | C17H17ClN2O |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 9-butyl-4-chloro-2-methylpyrido[2,3-b]indole-3-carbaldehyde |
| SMILES | CCCCn1c2ccccc2c2c(Cl)c(C=O)c(C)nc21 |
| InChI | InChI=1S/C17H17ClN2O/c1-3-4-9-20-14-8-6-5-7-12(14)15-16(18)13(10-21)11(2)19-17(15)20/h5-8,10H,3-4,9H2,1-2H3 |
| InChIKey | PVILBOQAFAESNF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|