C8H15N — CID 135059859
(1S,8R)-1-(deuteriomethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine (PubChem CID 135059859) has the molecular formula C8H15N and a molecular weight of 126.22 g/mol. Its IUPAC name is (1S,8R)-1-(deuteriomethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine.
| Compound Name | (1S,8R)-1-(deuteriomethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 135059859 |
| Molecular Formula | C8H15N |
| Molecular Weight | 126.22 g/mol |
| Exact Mass | 126.13 |
| IUPAC Name | (1S,8R)-1-(deuteriomethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
| SMILES | [2H]C[C@H]1CCN2CCC[C@H]12 |
| InChI | InChI=1S/C8H15N/c1-7-4-6-9-5-2-3-8(7)9/h7-8H,2-6H2,1H3/t7-,8+/m0/s1/i1D |
| InChIKey | BFHBAQJJQJPDGF-LHAKFJKNSA-N |
| XLogP | 1.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |