About 4,4-dimethyl-3-(2-methylpent-4-enoyl)-1,3-oxazolidin-2-one
4,4-dimethyl-3-(2-methylpent-4-enoyl)-1,3-oxazolidin-2-one (PubChem CID 135059860) has the molecular formula C11H17NO3
and a molecular weight of 211.26 g/mol. Its IUPAC name is 4,4-dimethyl-3-(2-methylpent-4-enoyl)-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 4,4-dimethyl-3-(2-methylpent-4-enoyl)-1,3-oxazolidin-2-one |
| PubChem CID | 135059860 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 4,4-dimethyl-3-(2-methylpent-4-enoyl)-1,3-oxazolidin-2-one |
| SMILES | C=CCC(C)C(=O)N1C(=O)OCC1(C)C |
| InChI | InChI=1S/C11H17NO3/c1-5-6-8(2)9(13)12-10(14)15-7-11(12,3)4/h5,8H,1,6-7H2,2-4H3 |
| InChIKey | YMKONRGRGANDQQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dimethyl-3-(2-methylpent-4-enoyl)-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-3-(2-methylpent-4-enoyl)-1,3-oxazolidin-2-one?
The IUPAC name of 4,4-dimethyl-3-(2-methylpent-4-enoyl)-1,3-oxazolidin-2-one (CID 135059860) is 4,4-dimethyl-3-(2-methylpent-4-enoyl)-1,3-oxazolidin-2-one.
What is the SMILES notation for 4,4-dimethyl-3-(2-methylpent-4-enoyl)-1,3-oxazolidin-2-one?
The canonical SMILES for 4,4-dimethyl-3-(2-methylpent-4-enoyl)-1,3-oxazolidin-2-one is C=CCC(C)C(=O)N1C(=O)OCC1(C)C.
What is the InChIKey of 4,4-dimethyl-3-(2-methylpent-4-enoyl)-1,3-oxazolidin-2-one?
The InChIKey is YMKONRGRGANDQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO3/c1-5-6-8(2)9(13)12-10(14)15-7-11(12,3)4/h5,8H,1,6-7H2,2-4H3.
What are the key properties of 4,4-dimethyl-3-(2-methylpent-4-enoyl)-1,3-oxazolidin-2-one?
4,4-dimethyl-3-(2-methylpent-4-enoyl)-1,3-oxazolidin-2-one has a molecular weight of 211.26 g/mol, XLogP of 1.96, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-3-(2-methylpent-4-enoyl)-1,3-oxazolidin-2-one is sourced from PubChem (CID 135059860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).