About 3-(nitromethyl)heptanal
3-(nitromethyl)heptanal (PubChem CID 135060281) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is 3-(nitromethyl)heptanal.
Molecular Properties
| Compound Name | 3-(nitromethyl)heptanal |
| PubChem CID | 135060281 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | 3-(nitromethyl)heptanal |
| SMILES | CCCCC(CC=O)C[N+](=O)[O-] |
| InChI | InChI=1S/C8H15NO3/c1-2-3-4-8(5-6-10)7-9(11)12/h6,8H,2-5,7H2,1H3 |
| InChIKey | QONYLDATPJWMSJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(nitromethyl)heptanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(nitromethyl)heptanal?
The IUPAC name of 3-(nitromethyl)heptanal (CID 135060281) is 3-(nitromethyl)heptanal.
What is the SMILES notation for 3-(nitromethyl)heptanal?
The canonical SMILES for 3-(nitromethyl)heptanal is CCCCC(CC=O)C[N+](=O)[O-].
What is the InChIKey of 3-(nitromethyl)heptanal?
The InChIKey is QONYLDATPJWMSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3/c1-2-3-4-8(5-6-10)7-9(11)12/h6,8H,2-5,7H2,1H3.
What are the key properties of 3-(nitromethyl)heptanal?
3-(nitromethyl)heptanal has a molecular weight of 173.21 g/mol, XLogP of 1.66, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(nitromethyl)heptanal is sourced from PubChem (CID 135060281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).