C16H21N — CID 135060288
2-[(1S,4R)-2-bicyclo[2.2.1]heptanyl]-1,2,3,4-tetrahydroquinoline (PubChem CID 135060288) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is 2-[(1S,4R)-2-bicyclo[2.2.1]heptanyl]-1,2,3,4-tetrahydroquinoline.
| Compound Name | 2-[(1S,4R)-2-bicyclo[2.2.1]heptanyl]-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 135060288 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 2-[(1S,4R)-2-bicyclo[2.2.1]heptanyl]-1,2,3,4-tetrahydroquinoline |
| SMILES | c1ccc2c(c1)CCC(C1C[C@@H]3CC[C@H]1C3)N2 |
| InChI | InChI=1S/C16H21N/c1-2-4-15-12(3-1)7-8-16(17-15)14-10-11-5-6-13(14)9-11/h1-4,11,13-14,16-17H,5-10H2/t11-,13+,14?,16?/m1/s1 |
| InChIKey | LUNMFJHIMAFYEQ-WFBWGFEFSA-N |
| XLogP | 3.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |