About tert-butyl 3-[benzyl(methylsulfonyl)amino]-4-phenylpyrido[3,4-b]indole-9-carboxylate
tert-butyl 3-[benzyl(methylsulfonyl)amino]-4-phenylpyrido[3,4-b]indole-9-carboxylate (PubChem CID 135060381) has the molecular formula C30H29N3O4S
and a molecular weight of 527.65 g/mol. Its IUPAC name is tert-butyl 3-[benzyl(methylsulfonyl)amino]-4-phenylpyrido[3,4-b]indole-9-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3-[benzyl(methylsulfonyl)amino]-4-phenylpyrido[3,4-b]indole-9-carboxylate |
| PubChem CID | 135060381 |
| Molecular Formula | C30H29N3O4S |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | tert-butyl 3-[benzyl(methylsulfonyl)amino]-4-phenylpyrido[3,4-b]indole-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c2ccccc2c2c(-c3ccccc3)c(N(Cc3ccccc3)S(C)(=O)=O)ncc21 |
| InChI | InChI=1S/C30H29N3O4S/c1-30(2,3)37-29(34)33-24-18-12-11-17-23(24)27-25(33)19-31-28(26(27)22-15-9-6-10-16-22)32(38(4,35)36)20-21-13-7-5-8-14-21/h5-19H,20H2,1-4H3 |
| InChIKey | HHOCBGOJSWJLLR-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 3-[benzyl(methylsulfonyl)amino]-4-phenylpyrido[3,4-b]indole-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[benzyl(methylsulfonyl)amino]-4-phenylpyrido[3,4-b]indole-9-carboxylate?
The IUPAC name of tert-butyl 3-[benzyl(methylsulfonyl)amino]-4-phenylpyrido[3,4-b]indole-9-carboxylate (CID 135060381) is tert-butyl 3-[benzyl(methylsulfonyl)amino]-4-phenylpyrido[3,4-b]indole-9-carboxylate.
What is the SMILES notation for tert-butyl 3-[benzyl(methylsulfonyl)amino]-4-phenylpyrido[3,4-b]indole-9-carboxylate?
The canonical SMILES for tert-butyl 3-[benzyl(methylsulfonyl)amino]-4-phenylpyrido[3,4-b]indole-9-carboxylate is CC(C)(C)OC(=O)n1c2ccccc2c2c(-c3ccccc3)c(N(Cc3ccccc3)S(C)(=O)=O)ncc21.
What is the InChIKey of tert-butyl 3-[benzyl(methylsulfonyl)amino]-4-phenylpyrido[3,4-b]indole-9-carboxylate?
The InChIKey is HHOCBGOJSWJLLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H29N3O4S/c1-30(2,3)37-29(34)33-24-18-12-11-17-23(24)27-25(33)19-31-28(26(27)22-15-9-6-10-16-22)32(38(4,35)36)20-21-13-7-5-8-14-21/h5-19H,20H2,1-4H3.
What are the key properties of tert-butyl 3-[benzyl(methylsulfonyl)amino]-4-phenylpyrido[3,4-b]indole-9-carboxylate?
tert-butyl 3-[benzyl(methylsulfonyl)amino]-4-phenylpyrido[3,4-b]indole-9-carboxylate has a molecular weight of 527.65 g/mol, XLogP of 6.61, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[benzyl(methylsulfonyl)amino]-4-phenylpyrido[3,4-b]indole-9-carboxylate is sourced from PubChem (CID 135060381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).