About 4-prop-2-enoxycinnoline
4-prop-2-enoxycinnoline (PubChem CID 135060412) has the molecular formula C11H10N2O
and a molecular weight of 186.21 g/mol. Its IUPAC name is 4-prop-2-enoxycinnoline.
Molecular Properties
| Compound Name | 4-prop-2-enoxycinnoline |
| PubChem CID | 135060412 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 4-prop-2-enoxycinnoline |
| SMILES | C=CCOc1cnnc2ccccc12 |
| InChI | InChI=1S/C11H10N2O/c1-2-7-14-11-8-12-13-10-6-4-3-5-9(10)11/h2-6,8H,1,7H2 |
| InChIKey | IZWNLZCLZPPRSP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-prop-2-enoxycinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-prop-2-enoxycinnoline?
The IUPAC name of 4-prop-2-enoxycinnoline (CID 135060412) is 4-prop-2-enoxycinnoline.
What is the SMILES notation for 4-prop-2-enoxycinnoline?
The canonical SMILES for 4-prop-2-enoxycinnoline is C=CCOc1cnnc2ccccc12.
What is the InChIKey of 4-prop-2-enoxycinnoline?
The InChIKey is IZWNLZCLZPPRSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O/c1-2-7-14-11-8-12-13-10-6-4-3-5-9(10)11/h2-6,8H,1,7H2.
What are the key properties of 4-prop-2-enoxycinnoline?
4-prop-2-enoxycinnoline has a molecular weight of 186.21 g/mol, XLogP of 2.19, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-prop-2-enoxycinnoline is sourced from PubChem (CID 135060412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).