About N,2-bis(2-hydroxyethyl)-3-oxo-5H-pyrido[4,3-b]indole-4-carboxamide
N,2-bis(2-hydroxyethyl)-3-oxo-5H-pyrido[4,3-b]indole-4-carboxamide (PubChem CID 135060471) has the molecular formula C16H17N3O4
and a molecular weight of 315.33 g/mol. Its IUPAC name is N,2-bis(2-hydroxyethyl)-3-oxo-5H-pyrido[4,3-b]indole-4-carboxamide.
Molecular Properties
| Compound Name | N,2-bis(2-hydroxyethyl)-3-oxo-5H-pyrido[4,3-b]indole-4-carboxamide |
| PubChem CID | 135060471 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | N,2-bis(2-hydroxyethyl)-3-oxo-5H-pyrido[4,3-b]indole-4-carboxamide |
| SMILES | O=C(NCCO)c1c(=O)n(CCO)cc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C16H17N3O4/c20-7-5-17-15(22)13-14-11(9-19(6-8-21)16(13)23)10-3-1-2-4-12(10)18-14/h1-4,9,18,20-21H,5-8H2,(H,17,22) |
| InChIKey | AICLDBFAHLDRKF-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,2-bis(2-hydroxyethyl)-3-oxo-5H-pyrido[4,3-b]indole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-bis(2-hydroxyethyl)-3-oxo-5H-pyrido[4,3-b]indole-4-carboxamide?
The IUPAC name of N,2-bis(2-hydroxyethyl)-3-oxo-5H-pyrido[4,3-b]indole-4-carboxamide (CID 135060471) is N,2-bis(2-hydroxyethyl)-3-oxo-5H-pyrido[4,3-b]indole-4-carboxamide.
What is the SMILES notation for N,2-bis(2-hydroxyethyl)-3-oxo-5H-pyrido[4,3-b]indole-4-carboxamide?
The canonical SMILES for N,2-bis(2-hydroxyethyl)-3-oxo-5H-pyrido[4,3-b]indole-4-carboxamide is O=C(NCCO)c1c(=O)n(CCO)cc2c1[nH]c1ccccc12.
What is the InChIKey of N,2-bis(2-hydroxyethyl)-3-oxo-5H-pyrido[4,3-b]indole-4-carboxamide?
The InChIKey is AICLDBFAHLDRKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O4/c20-7-5-17-15(22)13-14-11(9-19(6-8-21)16(13)23)10-3-1-2-4-12(10)18-14/h1-4,9,18,20-21H,5-8H2,(H,17,22).
What are the key properties of N,2-bis(2-hydroxyethyl)-3-oxo-5H-pyrido[4,3-b]indole-4-carboxamide?
N,2-bis(2-hydroxyethyl)-3-oxo-5H-pyrido[4,3-b]indole-4-carboxamide has a molecular weight of 315.33 g/mol, XLogP of 0.20, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-bis(2-hydroxyethyl)-3-oxo-5H-pyrido[4,3-b]indole-4-carboxamide is sourced from PubChem (CID 135060471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).