C19H16N2O2 — CID 135060648
5-(3,5-dimethoxyphenyl)pyrido[3,2-b]indole (PubChem CID 135060648) has the molecular formula C19H16N2O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 5-(3,5-dimethoxyphenyl)pyrido[3,2-b]indole.
| Compound Name | 5-(3,5-dimethoxyphenyl)pyrido[3,2-b]indole |
|---|---|
| PubChem CID | 135060648 |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 5-(3,5-dimethoxyphenyl)pyrido[3,2-b]indole |
| SMILES | COc1cc(OC)cc(-n2c3ccccc3c3ncccc32)c1 |
| InChI | InChI=1S/C19H16N2O2/c1-22-14-10-13(11-15(12-14)23-2)21-17-7-4-3-6-16(17)19-18(21)8-5-9-20-19/h3-12H,1-2H3 |
| InChIKey | KVSSNCOOLXVTID-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |