About 1-[(1E)-3-phenylbuta-1,3-dienyl]pyrazole
1-[(1E)-3-phenylbuta-1,3-dienyl]pyrazole (PubChem CID 135060716) has the molecular formula C13H12N2
and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-[(1E)-3-phenylbuta-1,3-dienyl]pyrazole.
Molecular Properties
| Compound Name | 1-[(1E)-3-phenylbuta-1,3-dienyl]pyrazole |
| PubChem CID | 135060716 |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1-[(1E)-3-phenylbuta-1,3-dienyl]pyrazole |
| SMILES | C=C(/C=C/n1cccn1)c1ccccc1 |
| InChI | InChI=1S/C13H12N2/c1-12(13-6-3-2-4-7-13)8-11-15-10-5-9-14-15/h2-11H,1H2/b11-8+ |
| InChIKey | NLKVSYMUTRREMC-DHZHZOJOSA-N |
| XLogP | 3.07 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1E)-3-phenylbuta-1,3-dienyl]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1E)-3-phenylbuta-1,3-dienyl]pyrazole?
The IUPAC name of 1-[(1E)-3-phenylbuta-1,3-dienyl]pyrazole (CID 135060716) is 1-[(1E)-3-phenylbuta-1,3-dienyl]pyrazole.
What is the SMILES notation for 1-[(1E)-3-phenylbuta-1,3-dienyl]pyrazole?
The canonical SMILES for 1-[(1E)-3-phenylbuta-1,3-dienyl]pyrazole is C=C(/C=C/n1cccn1)c1ccccc1.
What is the InChIKey of 1-[(1E)-3-phenylbuta-1,3-dienyl]pyrazole?
The InChIKey is NLKVSYMUTRREMC-DHZHZOJOSA-N. The full InChI is InChI=1S/C13H12N2/c1-12(13-6-3-2-4-7-13)8-11-15-10-5-9-14-15/h2-11H,1H2/b11-8+.
What are the key properties of 1-[(1E)-3-phenylbuta-1,3-dienyl]pyrazole?
1-[(1E)-3-phenylbuta-1,3-dienyl]pyrazole has a molecular weight of 196.25 g/mol, XLogP of 3.07, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1E)-3-phenylbuta-1,3-dienyl]pyrazole is sourced from PubChem (CID 135060716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).