C10H17FO2 — CID 135060777
ethyl (Z)-2-fluoro-5,5-dimethylhex-2-enoate (PubChem CID 135060777) has the molecular formula C10H17FO2 and a molecular weight of 188.24 g/mol. Its IUPAC name is ethyl (Z)-2-fluoro-5,5-dimethylhex-2-enoate.
| Compound Name | ethyl (Z)-2-fluoro-5,5-dimethylhex-2-enoate |
|---|---|
| PubChem CID | 135060777 |
| Molecular Formula | C10H17FO2 |
| Molecular Weight | 188.24 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | ethyl (Z)-2-fluoro-5,5-dimethylhex-2-enoate |
| SMILES | CCOC(=O)/C(F)=C/CC(C)(C)C |
| InChI | InChI=1S/C10H17FO2/c1-5-13-9(12)8(11)6-7-10(2,3)4/h6H,5,7H2,1-4H3/b8-6- |
| InChIKey | NKFJWZKRRBXMHF-VURMDHGXSA-N |
| XLogP | 2.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.24 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|