C24H21FO4S2 — CID 135060780
[6,6-bis(benzenesulfonyl)-6-fluorohexa-2,3-dien-2-yl]benzene (PubChem CID 135060780) has the molecular formula C24H21FO4S2 and a molecular weight of 456.56 g/mol. Its IUPAC name is [6,6-bis(benzenesulfonyl)-6-fluorohexa-2,3-dien-2-yl]benzene.
| Compound Name | [6,6-bis(benzenesulfonyl)-6-fluorohexa-2,3-dien-2-yl]benzene |
|---|---|
| PubChem CID | 135060780 |
| Molecular Formula | C24H21FO4S2 |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | [6,6-bis(benzenesulfonyl)-6-fluorohexa-2,3-dien-2-yl]benzene |
| SMILES | CC(=C=CCC(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H21FO4S2/c1-20(21-13-5-2-6-14-21)12-11-19-24(25,30(26,27)22-15-7-3-8-16-22)31(28,29)23-17-9-4-10-18-23/h2-11,13-18H,19H2,1H3 |
| InChIKey | CJMQBVODDAAHSD-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |