C36H35FO6S — CID 135060785
[3-acetyloxy-5-fluoro-2-(4-methylphenyl)sulfanyl-6-(trityloxymethyl)oxan-4-yl] acetate (PubChem CID 135060785) has the molecular formula C36H35FO6S and a molecular weight of 614.74 g/mol. Its IUPAC name is [3-acetyloxy-5-fluoro-2-(4-methylphenyl)sulfanyl-6-(trityloxymethyl)oxan-4-yl] acetate.
| Compound Name | [3-acetyloxy-5-fluoro-2-(4-methylphenyl)sulfanyl-6-(trityloxymethyl)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 135060785 |
| Molecular Formula | C36H35FO6S |
| Molecular Weight | 614.74 g/mol |
| Exact Mass | 614.21 |
| IUPAC Name | [3-acetyloxy-5-fluoro-2-(4-methylphenyl)sulfanyl-6-(trityloxymethyl)oxan-4-yl] acetate |
| SMILES | CC(=O)OC1C(Sc2ccc(C)cc2)OC(COC(c2ccccc2)(c2ccccc2)c2ccccc2)C(F)C1OC(C)=O |
| InChI | InChI=1S/C36H35FO6S/c1-24-19-21-30(22-20-24)44-35-34(42-26(3)39)33(41-25(2)38)32(37)31(43-35)23-40-36(27-13-7-4-8-14-27,28-15-9-5-10-16-28)29-17-11-6-12-18-29/h4-22,31-35H,23H2,1-3H3 |
| InChIKey | WJXVOLQJXMSJJL-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.74 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|