C18H26O8 — CID 135060831
2-O-(2-methylidenebut-3-enyl) 3-O-prop-2-enyl 5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2,3-dicarboxylate (PubChem CID 135060831) has the molecular formula C18H26O8 and a molecular weight of 370.40 g/mol. Its IUPAC name is 2-O-(2-methylidenebut-3-enyl) 3-O-prop-2-enyl 5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2,3-dicarboxylate.
| Compound Name | 2-O-(2-methylidenebut-3-enyl) 3-O-prop-2-enyl 5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 135060831 |
| Molecular Formula | C18H26O8 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 2-O-(2-methylidenebut-3-enyl) 3-O-prop-2-enyl 5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2,3-dicarboxylate |
| SMILES | C=CCOC(=O)C1OC(C)(OC)C(C)(OC)OC1C(=O)OCC(=C)C=C |
| InChI | InChI=1S/C18H26O8/c1-8-10-23-15(19)13-14(16(20)24-11-12(3)9-2)26-18(5,22-7)17(4,21-6)25-13/h8-9,13-14H,1-3,10-11H2,4-7H3 |
| InChIKey | WCRKZJDECWRYLQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|