About 2,3-dibenzyl-7-(4-methoxyphenyl)-4-phenyl-1H-pyrrolo[3,2-c]pyridine
2,3-dibenzyl-7-(4-methoxyphenyl)-4-phenyl-1H-pyrrolo[3,2-c]pyridine (PubChem CID 135060859) has the molecular formula C34H28N2O
and a molecular weight of 480.61 g/mol. Its IUPAC name is 2,3-dibenzyl-7-(4-methoxyphenyl)-4-phenyl-1H-pyrrolo[3,2-c]pyridine.
Molecular Properties
| Compound Name | 2,3-dibenzyl-7-(4-methoxyphenyl)-4-phenyl-1H-pyrrolo[3,2-c]pyridine |
| PubChem CID | 135060859 |
| Molecular Formula | C34H28N2O |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 2,3-dibenzyl-7-(4-methoxyphenyl)-4-phenyl-1H-pyrrolo[3,2-c]pyridine |
| SMILES | COc1ccc(-c2cnc(-c3ccccc3)c3c(Cc4ccccc4)c(Cc4ccccc4)[nH]c23)cc1 |
| InChI | InChI=1S/C34H28N2O/c1-37-28-19-17-26(18-20-28)30-23-35-33(27-15-9-4-10-16-27)32-29(21-24-11-5-2-6-12-24)31(36-34(30)32)22-25-13-7-3-8-14-25/h2-20,23,36H,21-22H2,1H3 |
| InChIKey | NDYFZRWXYCSLHQ-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dibenzyl-7-(4-methoxyphenyl)-4-phenyl-1H-pyrrolo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dibenzyl-7-(4-methoxyphenyl)-4-phenyl-1H-pyrrolo[3,2-c]pyridine?
The IUPAC name of 2,3-dibenzyl-7-(4-methoxyphenyl)-4-phenyl-1H-pyrrolo[3,2-c]pyridine (CID 135060859) is 2,3-dibenzyl-7-(4-methoxyphenyl)-4-phenyl-1H-pyrrolo[3,2-c]pyridine.
What is the SMILES notation for 2,3-dibenzyl-7-(4-methoxyphenyl)-4-phenyl-1H-pyrrolo[3,2-c]pyridine?
The canonical SMILES for 2,3-dibenzyl-7-(4-methoxyphenyl)-4-phenyl-1H-pyrrolo[3,2-c]pyridine is COc1ccc(-c2cnc(-c3ccccc3)c3c(Cc4ccccc4)c(Cc4ccccc4)[nH]c23)cc1.
What is the InChIKey of 2,3-dibenzyl-7-(4-methoxyphenyl)-4-phenyl-1H-pyrrolo[3,2-c]pyridine?
The InChIKey is NDYFZRWXYCSLHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H28N2O/c1-37-28-19-17-26(18-20-28)30-23-35-33(27-15-9-4-10-16-27)32-29(21-24-11-5-2-6-12-24)31(36-34(30)32)22-25-13-7-3-8-14-25/h2-20,23,36H,21-22H2,1H3.
What are the key properties of 2,3-dibenzyl-7-(4-methoxyphenyl)-4-phenyl-1H-pyrrolo[3,2-c]pyridine?
2,3-dibenzyl-7-(4-methoxyphenyl)-4-phenyl-1H-pyrrolo[3,2-c]pyridine has a molecular weight of 480.61 g/mol, XLogP of 8.09, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dibenzyl-7-(4-methoxyphenyl)-4-phenyl-1H-pyrrolo[3,2-c]pyridine is sourced from PubChem (CID 135060859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).