C37H62O5Si3 — CID 135060955
diethyl (3S,9S)-6-[tert-butyl(dimethyl)silyl]oxy-3,9-bis[dimethyl(phenyl)silyl]undecanedioate (PubChem CID 135060955) has the molecular formula C37H62O5Si3 and a molecular weight of 671.16 g/mol. Its IUPAC name is diethyl (3S,9S)-6-[tert-butyl(dimethyl)silyl]oxy-3,9-bis[dimethyl(phenyl)silyl]undecanedioate.
| Compound Name | diethyl (3S,9S)-6-[tert-butyl(dimethyl)silyl]oxy-3,9-bis[dimethyl(phenyl)silyl]undecanedioate |
|---|---|
| PubChem CID | 135060955 |
| Molecular Formula | C37H62O5Si3 |
| Molecular Weight | 671.16 g/mol |
| Exact Mass | 670.39 |
| IUPAC Name | diethyl (3S,9S)-6-[tert-butyl(dimethyl)silyl]oxy-3,9-bis[dimethyl(phenyl)silyl]undecanedioate |
| SMILES | CCOC(=O)C[C@H](CCC(CC[C@@H](CC(=O)OCC)[Si](C)(C)c1ccccc1)O[Si](C)(C)C(C)(C)C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C37H62O5Si3/c1-12-40-35(38)28-33(43(6,7)31-20-16-14-17-21-31)26-24-30(42-45(10,11)37(3,4)5)25-27-34(29-36(39)41-13-2)44(8,9)32-22-18-15-19-23-32/h14-23,30,33-34H,12-13,24-29H2,1-11H3/t33-,34-/m0/s1 |
| InChIKey | QFQDYFYSTNXSGY-HEVIKAOCSA-N |
| XLogP | 8.82 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.16 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|