C25H32BFO4Si — CID 135060968
ethyl (Z)-2-[dimethyl(phenyl)silyl]-3-(4-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoate (PubChem CID 135060968) has the molecular formula C25H32BFO4Si and a molecular weight of 454.42 g/mol. Its IUPAC name is ethyl (Z)-2-[dimethyl(phenyl)silyl]-3-(4-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoate.
| Compound Name | ethyl (Z)-2-[dimethyl(phenyl)silyl]-3-(4-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 135060968 |
| Molecular Formula | C25H32BFO4Si |
| Molecular Weight | 454.42 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | ethyl (Z)-2-[dimethyl(phenyl)silyl]-3-(4-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C(\B1OC(C)(C)C(C)(C)O1)c1ccc(F)cc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C25H32BFO4Si/c1-8-29-23(28)22(32(6,7)20-12-10-9-11-13-20)21(18-14-16-19(27)17-15-18)26-30-24(2,3)25(4,5)31-26/h9-17H,8H2,1-7H3/b22-21+ |
| InChIKey | QVFVTPFJHVKEBL-QURGRASLSA-N |
| XLogP | 4.93 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.42 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|