About 3-[phenyl(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-1H-pyrrolo[2,3-b]pyridine
3-[phenyl(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 135061169) has the molecular formula C21H16N4
and a molecular weight of 324.39 g/mol. Its IUPAC name is 3-[phenyl(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 3-[phenyl(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 135061169 |
| Molecular Formula | C21H16N4 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 3-[phenyl(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | c1ccc(C(c2c[nH]c3ncccc23)c2c[nH]c3ncccc23)cc1 |
| InChI | InChI=1S/C21H16N4/c1-2-6-14(7-3-1)19(17-12-24-20-15(17)8-4-10-22-20)18-13-25-21-16(18)9-5-11-23-21/h1-13,19H,(H,22,24)(H,23,25) |
| InChIKey | MELVJLXSRZRTAJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[phenyl(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[phenyl(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 3-[phenyl(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-1H-pyrrolo[2,3-b]pyridine (CID 135061169) is 3-[phenyl(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 3-[phenyl(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 3-[phenyl(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-1H-pyrrolo[2,3-b]pyridine is c1ccc(C(c2c[nH]c3ncccc23)c2c[nH]c3ncccc23)cc1.
What is the InChIKey of 3-[phenyl(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is MELVJLXSRZRTAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N4/c1-2-6-14(7-3-1)19(17-12-24-20-15(17)8-4-10-22-20)18-13-25-21-16(18)9-5-11-23-21/h1-13,19H,(H,22,24)(H,23,25).
What are the key properties of 3-[phenyl(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-1H-pyrrolo[2,3-b]pyridine?
3-[phenyl(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 324.39 g/mol, XLogP of 4.62, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[phenyl(1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 135061169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).