C14H16BrNO2 — CID 135061181
methyl (4aS,9aR)-7-bromo-1,2,3,4,4a,9a-hexahydrocarbazole-9-carboxylate (PubChem CID 135061181) has the molecular formula C14H16BrNO2 and a molecular weight of 310.19 g/mol. Its IUPAC name is methyl (4aS,9aR)-7-bromo-1,2,3,4,4a,9a-hexahydrocarbazole-9-carboxylate.
| Compound Name | methyl (4aS,9aR)-7-bromo-1,2,3,4,4a,9a-hexahydrocarbazole-9-carboxylate |
|---|---|
| PubChem CID | 135061181 |
| Molecular Formula | C14H16BrNO2 |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | methyl (4aS,9aR)-7-bromo-1,2,3,4,4a,9a-hexahydrocarbazole-9-carboxylate |
| SMILES | COC(=O)N1c2cc(Br)ccc2[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C14H16BrNO2/c1-18-14(17)16-12-5-3-2-4-10(12)11-7-6-9(15)8-13(11)16/h6-8,10,12H,2-5H2,1H3/t10-,12+/m0/s1 |
| InChIKey | VQTSUEGHZLACMM-CMPLNLGQSA-N |
| XLogP | 4.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |