About N-[(1R,2R)-2-chloro-1-(4-fluorophenyl)-3-oxo-3-phenylpropyl]-4-methylbenzenesulfonamide
N-[(1R,2R)-2-chloro-1-(4-fluorophenyl)-3-oxo-3-phenylpropyl]-4-methylbenzenesulfonamide (PubChem CID 135061258) has the molecular formula C22H19ClFNO3S
and a molecular weight of 431.92 g/mol. Its IUPAC name is N-[(1R,2R)-2-chloro-1-(4-fluorophenyl)-3-oxo-3-phenylpropyl]-4-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-[(1R,2R)-2-chloro-1-(4-fluorophenyl)-3-oxo-3-phenylpropyl]-4-methylbenzenesulfonamide |
| PubChem CID | 135061258 |
| Molecular Formula | C22H19ClFNO3S |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | N-[(1R,2R)-2-chloro-1-(4-fluorophenyl)-3-oxo-3-phenylpropyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](c2ccc(F)cc2)[C@@H](Cl)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H19ClFNO3S/c1-15-7-13-19(14-8-15)29(27,28)25-21(16-9-11-18(24)12-10-16)20(23)22(26)17-5-3-2-4-6-17/h2-14,20-21,25H,1H3/t20-,21-/m1/s1 |
| InChIKey | GEPIEHRDAFKATO-NHCUHLMSSA-N |
| XLogP | 4.64 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[(1R,2R)-2-chloro-1-(4-fluorophenyl)-3-oxo-3-phenylpropyl]-4-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,2R)-2-chloro-1-(4-fluorophenyl)-3-oxo-3-phenylpropyl]-4-methylbenzenesulfonamide?
The IUPAC name of N-[(1R,2R)-2-chloro-1-(4-fluorophenyl)-3-oxo-3-phenylpropyl]-4-methylbenzenesulfonamide (CID 135061258) is N-[(1R,2R)-2-chloro-1-(4-fluorophenyl)-3-oxo-3-phenylpropyl]-4-methylbenzenesulfonamide.
What is the SMILES notation for N-[(1R,2R)-2-chloro-1-(4-fluorophenyl)-3-oxo-3-phenylpropyl]-4-methylbenzenesulfonamide?
The canonical SMILES for N-[(1R,2R)-2-chloro-1-(4-fluorophenyl)-3-oxo-3-phenylpropyl]-4-methylbenzenesulfonamide is Cc1ccc(S(=O)(=O)N[C@H](c2ccc(F)cc2)[C@@H](Cl)C(=O)c2ccccc2)cc1.
What is the InChIKey of N-[(1R,2R)-2-chloro-1-(4-fluorophenyl)-3-oxo-3-phenylpropyl]-4-methylbenzenesulfonamide?
The InChIKey is GEPIEHRDAFKATO-NHCUHLMSSA-N. The full InChI is InChI=1S/C22H19ClFNO3S/c1-15-7-13-19(14-8-15)29(27,28)25-21(16-9-11-18(24)12-10-16)20(23)22(26)17-5-3-2-4-6-17/h2-14,20-21,25H,1H3/t20-,21-/m1/s1.
What are the key properties of N-[(1R,2R)-2-chloro-1-(4-fluorophenyl)-3-oxo-3-phenylpropyl]-4-methylbenzenesulfonamide?
N-[(1R,2R)-2-chloro-1-(4-fluorophenyl)-3-oxo-3-phenylpropyl]-4-methylbenzenesulfonamide has a molecular weight of 431.92 g/mol, XLogP of 4.64, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,2R)-2-chloro-1-(4-fluorophenyl)-3-oxo-3-phenylpropyl]-4-methylbenzenesulfonamide is sourced from PubChem (CID 135061258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).