About 2,2-dimethyl-5-(3-methylidenehept-1-ynyl)-3,6-dihydrooxasiline
2,2-dimethyl-5-(3-methylidenehept-1-ynyl)-3,6-dihydrooxasiline (PubChem CID 135061443) has the molecular formula C14H22OSi
and a molecular weight of 234.41 g/mol. Its IUPAC name is 2,2-dimethyl-5-(3-methylidenehept-1-ynyl)-3,6-dihydrooxasiline.
Molecular Properties
| Compound Name | 2,2-dimethyl-5-(3-methylidenehept-1-ynyl)-3,6-dihydrooxasiline |
| PubChem CID | 135061443 |
| Molecular Formula | C14H22OSi |
| Molecular Weight | 234.41 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 2,2-dimethyl-5-(3-methylidenehept-1-ynyl)-3,6-dihydrooxasiline |
| SMILES | C=C(C#CC1=CC[Si](C)(C)OC1)CCCC |
| InChI | InChI=1S/C14H22OSi/c1-5-6-7-13(2)8-9-14-10-11-16(3,4)15-12-14/h10H,2,5-7,11-12H2,1,3-4H3 |
| InChIKey | OBDDZJBQGFHQRW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-5-(3-methylidenehept-1-ynyl)-3,6-dihydrooxasiline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-5-(3-methylidenehept-1-ynyl)-3,6-dihydrooxasiline?
The IUPAC name of 2,2-dimethyl-5-(3-methylidenehept-1-ynyl)-3,6-dihydrooxasiline (CID 135061443) is 2,2-dimethyl-5-(3-methylidenehept-1-ynyl)-3,6-dihydrooxasiline.
What is the SMILES notation for 2,2-dimethyl-5-(3-methylidenehept-1-ynyl)-3,6-dihydrooxasiline?
The canonical SMILES for 2,2-dimethyl-5-(3-methylidenehept-1-ynyl)-3,6-dihydrooxasiline is C=C(C#CC1=CC[Si](C)(C)OC1)CCCC.
What is the InChIKey of 2,2-dimethyl-5-(3-methylidenehept-1-ynyl)-3,6-dihydrooxasiline?
The InChIKey is OBDDZJBQGFHQRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22OSi/c1-5-6-7-13(2)8-9-14-10-11-16(3,4)15-12-14/h10H,2,5-7,11-12H2,1,3-4H3.
What are the key properties of 2,2-dimethyl-5-(3-methylidenehept-1-ynyl)-3,6-dihydrooxasiline?
2,2-dimethyl-5-(3-methylidenehept-1-ynyl)-3,6-dihydrooxasiline has a molecular weight of 234.41 g/mol, XLogP of 3.90, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-5-(3-methylidenehept-1-ynyl)-3,6-dihydrooxasiline is sourced from PubChem (CID 135061443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).