About trans-benzyl (1S,2R)-2-fluoro-1-methyl-2-(morpholine-4-carbonyl)cyclopropane-1-carboxylate
trans-benzyl (1S,2R)-2-fluoro-1-methyl-2-(morpholine-4-carbonyl)cyclopropane-1-carboxylate (PubChem CID 135061603) has the molecular formula C17H20FNO4
and a molecular weight of 321.35 g/mol. Its IUPAC name is trans-benzyl (1S,2R)-2-fluoro-1-methyl-2-(morpholine-4-carbonyl)cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | trans-benzyl (1S,2R)-2-fluoro-1-methyl-2-(morpholine-4-carbonyl)cyclopropane-1-carboxylate |
| PubChem CID | 135061603 |
| Molecular Formula | C17H20FNO4 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | trans-benzyl (1S,2R)-2-fluoro-1-methyl-2-(morpholine-4-carbonyl)cyclopropane-1-carboxylate |
| SMILES | C[C@@]1(C(=O)OCc2ccccc2)C[C@]1(F)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C17H20FNO4/c1-16(15(21)23-11-13-5-3-2-4-6-13)12-17(16,18)14(20)19-7-9-22-10-8-19/h2-6H,7-12H2,1H3/t16-,17-/m0/s1 |
| InChIKey | QXALBJLHLJRXQG-IRXDYDNUSA-N |
| XLogP | 1.71 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze trans-benzyl (1S,2R)-2-fluoro-1-methyl-2-(morpholine-4-carbonyl)cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-benzyl (1S,2R)-2-fluoro-1-methyl-2-(morpholine-4-carbonyl)cyclopropane-1-carboxylate?
The IUPAC name of trans-benzyl (1S,2R)-2-fluoro-1-methyl-2-(morpholine-4-carbonyl)cyclopropane-1-carboxylate (CID 135061603) is trans-benzyl (1S,2R)-2-fluoro-1-methyl-2-(morpholine-4-carbonyl)cyclopropane-1-carboxylate.
What is the SMILES notation for trans-benzyl (1S,2R)-2-fluoro-1-methyl-2-(morpholine-4-carbonyl)cyclopropane-1-carboxylate?
The canonical SMILES for trans-benzyl (1S,2R)-2-fluoro-1-methyl-2-(morpholine-4-carbonyl)cyclopropane-1-carboxylate is C[C@@]1(C(=O)OCc2ccccc2)C[C@]1(F)C(=O)N1CCOCC1.
What is the InChIKey of trans-benzyl (1S,2R)-2-fluoro-1-methyl-2-(morpholine-4-carbonyl)cyclopropane-1-carboxylate?
The InChIKey is QXALBJLHLJRXQG-IRXDYDNUSA-N. The full InChI is InChI=1S/C17H20FNO4/c1-16(15(21)23-11-13-5-3-2-4-6-13)12-17(16,18)14(20)19-7-9-22-10-8-19/h2-6H,7-12H2,1H3/t16-,17-/m0/s1.
What are the key properties of trans-benzyl (1S,2R)-2-fluoro-1-methyl-2-(morpholine-4-carbonyl)cyclopropane-1-carboxylate?
trans-benzyl (1S,2R)-2-fluoro-1-methyl-2-(morpholine-4-carbonyl)cyclopropane-1-carboxylate has a molecular weight of 321.35 g/mol, XLogP of 1.71, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trans-benzyl (1S,2R)-2-fluoro-1-methyl-2-(morpholine-4-carbonyl)cyclopropane-1-carboxylate is sourced from PubChem (CID 135061603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).