About (1S,2S)-1-fluoro-3,3-dimethyl-1-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]butan-2-ol
(1S,2S)-1-fluoro-3,3-dimethyl-1-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]butan-2-ol (PubChem CID 135061759) has the molecular formula C19H23FO2S
and a molecular weight of 334.46 g/mol. Its IUPAC name is (1S,2S)-1-fluoro-3,3-dimethyl-1-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]butan-2-ol.
Molecular Properties
| Compound Name | (1S,2S)-1-fluoro-3,3-dimethyl-1-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]butan-2-ol |
| PubChem CID | 135061759 |
| Molecular Formula | C19H23FO2S |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (1S,2S)-1-fluoro-3,3-dimethyl-1-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]butan-2-ol |
| SMILES | Cc1ccc([S@](=O)c2ccccc2[C@H](F)[C@@H](O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H23FO2S/c1-13-9-11-14(12-10-13)23(22)16-8-6-5-7-15(16)17(20)18(21)19(2,3)4/h5-12,17-18,21H,1-4H3/t17-,18+,23-/m0/s1 |
| InChIKey | COPSUBDCOGLSKS-IXFSTUDKSA-N |
| XLogP | 4.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S,2S)-1-fluoro-3,3-dimethyl-1-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2S)-1-fluoro-3,3-dimethyl-1-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]butan-2-ol?
The IUPAC name of (1S,2S)-1-fluoro-3,3-dimethyl-1-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]butan-2-ol (CID 135061759) is (1S,2S)-1-fluoro-3,3-dimethyl-1-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]butan-2-ol.
What is the SMILES notation for (1S,2S)-1-fluoro-3,3-dimethyl-1-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]butan-2-ol?
The canonical SMILES for (1S,2S)-1-fluoro-3,3-dimethyl-1-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]butan-2-ol is Cc1ccc([S@](=O)c2ccccc2[C@H](F)[C@@H](O)C(C)(C)C)cc1.
What is the InChIKey of (1S,2S)-1-fluoro-3,3-dimethyl-1-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]butan-2-ol?
The InChIKey is COPSUBDCOGLSKS-IXFSTUDKSA-N. The full InChI is InChI=1S/C19H23FO2S/c1-13-9-11-14(12-10-13)23(22)16-8-6-5-7-15(16)17(20)18(21)19(2,3)4/h5-12,17-18,21H,1-4H3/t17-,18+,23-/m0/s1.
What are the key properties of (1S,2S)-1-fluoro-3,3-dimethyl-1-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]butan-2-ol?
(1S,2S)-1-fluoro-3,3-dimethyl-1-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]butan-2-ol has a molecular weight of 334.46 g/mol, XLogP of 4.58, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2S)-1-fluoro-3,3-dimethyl-1-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]butan-2-ol is sourced from PubChem (CID 135061759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).