C34H32N2O6 — CID 135061844
(2S,3S,4S,5S)-1-hydroxy-2-[2-(4-nitrophenyl)ethynyl]-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidine (PubChem CID 135061844) has the molecular formula C34H32N2O6 and a molecular weight of 564.64 g/mol. Its IUPAC name is (2S,3S,4S,5S)-1-hydroxy-2-[2-(4-nitrophenyl)ethynyl]-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidine.
| Compound Name | (2S,3S,4S,5S)-1-hydroxy-2-[2-(4-nitrophenyl)ethynyl]-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidine |
|---|---|
| PubChem CID | 135061844 |
| Molecular Formula | C34H32N2O6 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | (2S,3S,4S,5S)-1-hydroxy-2-[2-(4-nitrophenyl)ethynyl]-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidine |
| SMILES | O=[N+]([O-])c1ccc(C#C[C@H]2[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](COCc3ccccc3)N2O)cc1 |
| InChI | InChI=1S/C34H32N2O6/c37-35-31(21-18-26-16-19-30(20-17-26)36(38)39)33(41-23-28-12-6-2-7-13-28)34(42-24-29-14-8-3-9-15-29)32(35)25-40-22-27-10-4-1-5-11-27/h1-17,19-20,31-34,37H,22-25H2/t31-,32-,33-,34-/m0/s1 |
| InChIKey | BVDMIMDNZUDXTA-CUPIEXAXSA-N |
| XLogP | 5.78 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|