C15H17FO5 — CID 135061867
[(3aS,4S,6R,6aS)-4-fluoro-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl benzoate (PubChem CID 135061867) has the molecular formula C15H17FO5 and a molecular weight of 296.29 g/mol. Its IUPAC name is [(3aS,4S,6R,6aS)-4-fluoro-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl benzoate.
| Compound Name | [(3aS,4S,6R,6aS)-4-fluoro-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl benzoate |
|---|---|
| PubChem CID | 135061867 |
| Molecular Formula | C15H17FO5 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | [(3aS,4S,6R,6aS)-4-fluoro-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl benzoate |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H](F)O[C@@H]2COC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H17FO5/c1-15(2)20-11-10(19-13(16)12(11)21-15)8-18-14(17)9-6-4-3-5-7-9/h3-7,10-13H,8H2,1-2H3/t10-,11+,12+,13-/m1/s1 |
| InChIKey | VSXHLHPPBFHHCG-MROQNXINSA-N |
| XLogP | 2.06 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |