About (1,1-dimethyl-5-phenyl-2,5-dihydrosilol-3-yl)oxy-dimethyl-phenylsilane
(1,1-dimethyl-5-phenyl-2,5-dihydrosilol-3-yl)oxy-dimethyl-phenylsilane (PubChem CID 135062019) has the molecular formula C20H26OSi2
and a molecular weight of 338.60 g/mol. Its IUPAC name is (1,1-dimethyl-5-phenyl-2,5-dihydrosilol-3-yl)oxy-dimethyl-phenylsilane.
Molecular Properties
| Compound Name | (1,1-dimethyl-5-phenyl-2,5-dihydrosilol-3-yl)oxy-dimethyl-phenylsilane |
| PubChem CID | 135062019 |
| Molecular Formula | C20H26OSi2 |
| Molecular Weight | 338.60 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (1,1-dimethyl-5-phenyl-2,5-dihydrosilol-3-yl)oxy-dimethyl-phenylsilane |
| SMILES | C[Si](C)(OC1=CC(c2ccccc2)[Si](C)(C)C1)c1ccccc1 |
| InChI | InChI=1S/C20H26OSi2/c1-22(2)16-18(15-20(22)17-11-7-5-8-12-17)21-23(3,4)19-13-9-6-10-14-19/h5-15,20H,16H2,1-4H3 |
| InChIKey | BNGJKWWAMOZAAV-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.60 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (1,1-dimethyl-5-phenyl-2,5-dihydrosilol-3-yl)oxy-dimethyl-phenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,1-dimethyl-5-phenyl-2,5-dihydrosilol-3-yl)oxy-dimethyl-phenylsilane?
The IUPAC name of (1,1-dimethyl-5-phenyl-2,5-dihydrosilol-3-yl)oxy-dimethyl-phenylsilane (CID 135062019) is (1,1-dimethyl-5-phenyl-2,5-dihydrosilol-3-yl)oxy-dimethyl-phenylsilane.
What is the SMILES notation for (1,1-dimethyl-5-phenyl-2,5-dihydrosilol-3-yl)oxy-dimethyl-phenylsilane?
The canonical SMILES for (1,1-dimethyl-5-phenyl-2,5-dihydrosilol-3-yl)oxy-dimethyl-phenylsilane is C[Si](C)(OC1=CC(c2ccccc2)[Si](C)(C)C1)c1ccccc1.
What is the InChIKey of (1,1-dimethyl-5-phenyl-2,5-dihydrosilol-3-yl)oxy-dimethyl-phenylsilane?
The InChIKey is BNGJKWWAMOZAAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26OSi2/c1-22(2)16-18(15-20(22)17-11-7-5-8-12-17)21-23(3,4)19-13-9-6-10-14-19/h5-15,20H,16H2,1-4H3.
What are the key properties of (1,1-dimethyl-5-phenyl-2,5-dihydrosilol-3-yl)oxy-dimethyl-phenylsilane?
(1,1-dimethyl-5-phenyl-2,5-dihydrosilol-3-yl)oxy-dimethyl-phenylsilane has a molecular weight of 338.60 g/mol, XLogP of 5.04, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1,1-dimethyl-5-phenyl-2,5-dihydrosilol-3-yl)oxy-dimethyl-phenylsilane is sourced from PubChem (CID 135062019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).