C23H44O2Si2 — CID 135062069
(3E,5Z)-3-methyl-5-prop-2-enoxy-7,7-bis(triethylsilyl)hepta-3,5-dien-2-one (PubChem CID 135062069) has the molecular formula C23H44O2Si2 and a molecular weight of 408.78 g/mol. Its IUPAC name is (3E,5Z)-3-methyl-5-prop-2-enoxy-7,7-bis(triethylsilyl)hepta-3,5-dien-2-one.
| Compound Name | (3E,5Z)-3-methyl-5-prop-2-enoxy-7,7-bis(triethylsilyl)hepta-3,5-dien-2-one |
|---|---|
| PubChem CID | 135062069 |
| Molecular Formula | C23H44O2Si2 |
| Molecular Weight | 408.78 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | (3E,5Z)-3-methyl-5-prop-2-enoxy-7,7-bis(triethylsilyl)hepta-3,5-dien-2-one |
| SMILES | C=CCOC(=C\C([Si](CC)(CC)CC)[Si](CC)(CC)CC)/C=C(\C)C(C)=O |
| InChI | InChI=1S/C23H44O2Si2/c1-10-17-25-22(18-20(8)21(9)24)19-23(26(11-2,12-3)13-4)27(14-5,15-6)16-7/h10,18-19,23H,1,11-17H2,2-9H3/b20-18+,22-19- |
| InChIKey | AAIGKIJNKOPGSJ-IRZJRCTOSA-N |
| XLogP | 7.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.78 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|