C31H33FO6 — CID 135062077
(3aR,5S,6S,6aR)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-6-[(E)-2-(4-fluorophenyl)ethenoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 135062077) has the molecular formula C31H33FO6 and a molecular weight of 520.60 g/mol. Its IUPAC name is (3aR,5S,6S,6aR)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-6-[(E)-2-(4-fluorophenyl)ethenoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5S,6S,6aR)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-6-[(E)-2-(4-fluorophenyl)ethenoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 135062077 |
| Molecular Formula | C31H33FO6 |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | (3aR,5S,6S,6aR)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-6-[(E)-2-(4-fluorophenyl)ethenoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CC1(C)O[C@H]2O[C@@H]([C@@H](COCc3ccccc3)OCc3ccccc3)[C@H](O/C=C/c3ccc(F)cc3)[C@H]2O1 |
| InChI | InChI=1S/C31H33FO6/c1-31(2)37-29-28(34-18-17-22-13-15-25(32)16-14-22)27(36-30(29)38-31)26(35-20-24-11-7-4-8-12-24)21-33-19-23-9-5-3-6-10-23/h3-18,26-30H,19-21H2,1-2H3/b18-17+/t26-,27+,28+,29-,30-/m1/s1 |
| InChIKey | OAWYWLFJBULUCP-IVLHAGNWSA-N |
| XLogP | 5.86 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.60 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|